What is the molecular formula of 1-Isobutoxy-2-propanol?
The molecular formula of 1-Isobutoxy-2-propanol is C7H16O2.
What is the molecular weight of 1-Isobutoxy-2-propanol?
The molecular weight of 1-Isobutoxy-2-propanol is 132.20 g/mol.
What is the IUPAC name of 1-Isobutoxy-2-propanol?
The IUPAC name of 1-Isobutoxy-2-propanol is 1-(2-methylpropoxy)propan-2-ol.
What is the InChI of 1-Isobutoxy-2-propanol?
The InChI of 1-Isobutoxy-2-propanol is InChI=1S/C7H16O2/c1-6(2)4-9-5-7(3)8/h6-8H,4-5H2,1-3H3.
What is the InChIKey of 1-Isobutoxy-2-propanol?
The InChIKey of 1-Isobutoxy-2-propanol is MWGRRMQNSQNFID-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Isobutoxy-2-propanol?
The canonical SMILES of 1-Isobutoxy-2-propanol is CC(C)COCC(C)O.
What is the CAS number of 1-Isobutoxy-2-propanol?
The CAS number of 1-Isobutoxy-2-propanol is 23436-19-3.
What is the European Community (EC) number of 1-Isobutoxy-2-propanol?
The European Community (EC) number of 1-Isobutoxy-2-propanol is 245-663-9.
Is 1-Isobutoxy-2-propanol a canonicalized compound?
Yes, 1-Isobutoxy-2-propanol is a canonicalized compound.