What is the PubChem CID for 1,8-Diiodonaphthalene?
The PubChem CID for 1,8-Diiodonaphthalene is 633286.
What is the molecular formula of 1,8-Diiodonaphthalene?
The molecular formula of 1,8-Diiodonaphthalene is C10H6I2.
What is the molecular weight of 1,8-Diiodonaphthalene?
The molecular weight of 1,8-Diiodonaphthalene is 379.96 g/mol.
What is the IUPAC name of 1,8-Diiodonaphthalene?
The IUPAC name of 1,8-Diiodonaphthalene is 1,8-diiodonaphthalene.
What is the InChI (International Chemical Identifier) of 1,8-Diiodonaphthalene?
The InChI of 1,8-Diiodonaphthalene is InChI=1S/C10H6I2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H.
What is the InChIKey of 1,8-Diiodonaphthalene?
The InChIKey of 1,8-Diiodonaphthalene is FURHMGVKKGEGMZ-UHFFFAOYSA-N.
What is the canonical SMILES (Simplified Molecular Input Line Entry System) of 1,8-Diiodonaphthalene?
The canonical SMILES of 1,8-Diiodonaphthalene is C1=CC2=C(C(=C1)I)C(=CC=C2)I.
What is the CAS (Chemical Abstracts Service) number of 1,8-Diiodonaphthalene?
The CAS number of 1,8-Diiodonaphthalene is 1730-04-7.
What is the European Community (EC) number of 1,8-Diiodonaphthalene?
The European Community (EC) number of 1,8-Diiodonaphthalene is 686-033-7.
Is 1,8-Diiodonaphthalene a canonicalized compound?
Yes, 1,8-Diiodonaphthalene is a canonicalized compound according to PubChem.