What is the molecular formula of 1-Methylcyclopropanol?
The molecular formula of 1-Methylcyclopropanol is C4H8O.
What is the molecular weight of 1-Methylcyclopropanol?
The molecular weight of 1-Methylcyclopropanol is 72.11 g/mol.
What is the IUPAC name of 1-Methylcyclopropanol?
The IUPAC name of 1-Methylcyclopropanol is 1-methylcyclopropan-1-ol.
What is the InChI of 1-Methylcyclopropanol?
The InChI of 1-Methylcyclopropanol is InChI=1S/C4H8O/c1-4(5)2-3-4/h5H,2-3H2,1H3.
What is the InChIKey of 1-Methylcyclopropanol?
The InChIKey of 1-Methylcyclopropanol is NCTCZGRRDXIGIY-UHFFFAOYSA-N.
What is the CAS number of 1-Methylcyclopropanol?
The CAS number of 1-Methylcyclopropanol is 29526-99-6.
What is the EC number of 1-Methylcyclopropanol?
The EC number of 1-Methylcyclopropanol is 687-436-0.
What is the monoisotopic mass of 1-Methylcyclopropanol?
The monoisotopic mass of 1-Methylcyclopropanol is 72.057514874 g/mol.
What is the topological polar surface area of 1-Methylcyclopropanol?
The topological polar surface area of 1-Methylcyclopropanol is 20.2Ų.
Is 1-Methylcyclopropanol a canonicalized compound?
Yes, 1-Methylcyclopropanol is a canonicalized compound.