What is the molecular formula of Vitamin K2?
The molecular formula of Vitamin K2 is C31H40O2.
What is the molecular weight of Vitamin K2?
The molecular weight of Vitamin K2 is 444.6 g/mol.
What is the IUPAC name of Vitamin K2?
The IUPAC name of Vitamin K2 is 2-methyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene-1,4-dione.
What is the InChIKey of Vitamin K2?
The InChIKey of Vitamin K2 is DKHGMERMDICWDU-GHDNBGIDSA-N.
What is the canonical SMILES of Vitamin K2?
The canonical SMILES of Vitamin K2 is CC1=C(C(=O)C2=CC=CC=C2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C.
What is the CAS number of Vitamin K2?
The CAS number of Vitamin K2 is 863-61-6.
What is the ChEBI ID of Vitamin K2?
There is no information about the ChEBI ID of Vitamin K2 in the reference.
What is the DrugBank ID of Vitamin K2?
There is no information about the DrugBank ID of Vitamin K2 in the reference.
What is the UNII of Vitamin K2?
The UNII of Vitamin K2 is 27Y876D139.
What is the Wikipedia page for Vitamin K2?
The Wikipedia page for Vitamin K2 is "Menatetrenone."