What is the PubChem CID of tyramine?
The PubChem CID of tyramine is 5610.
What is the molecular formula of tyramine?
The molecular formula of tyramine is C8H11NO.
What are some synonyms for tyramine?
Some synonyms for tyramine include tyramine, 4-(2-Aminoethyl)phenol, p-Tyramine, and 4-Hydroxyphenethylamine.
What is the molecular weight of tyramine?
The molecular weight of tyramine is 137.18 g/mol.
When was tyramine created and modified in PubChem?
Tyramine was created on September 16, 2004, and last modified on November 25, 2023.
What is the IUPAC name of tyramine?
The IUPAC name of tyramine is 4-(2-aminoethyl)phenol.
What is the InChI of tyramine?
The InChI of tyramine is InChI=1S/C8H11NO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6,9H2.
What is the InChIKey of tyramine?
The InChIKey of tyramine is DZGWFCGJZKJUFP-UHFFFAOYSA-N.
What is the canonical SMILES of tyramine?
The canonical SMILES of tyramine is C1=CC(=CC=C1CCN)O.
What is the CAS number of tyramine?
The CAS number of tyramine is 51-67-2.