What is the molecular formula of trihexylamine?
The molecular formula of trihexylamine is C18H39N.
What is the molecular weight of trihexylamine?
The molecular weight of trihexylamine is 269.5 g/mol.
How is the IUPAC name of trihexylamine computed?
The IUPAC name of trihexylamine is computed as N,N-dihexylhexan-1-amine.
What is the InChI of trihexylamine?
The InChI of trihexylamine is "InChI=1S/C18H39N/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3".
What is the InChIKey of trihexylamine?
The InChIKey of trihexylamine is "DIAIBWNEUYXDNL-UHFFFAOYSA-N".
What is the canonical SMILES of trihexylamine?
The canonical SMILES of trihexylamine is "CCCCCCN(CCCCCC)CCCCCC".
What is the CAS number of trihexylamine?
The CAS number of trihexylamine is 102-86-3.
What is the XLogP3-AA value of trihexylamine?
The XLogP3-AA value of trihexylamine is 7.3.
How many rotatable bonds does trihexylamine have?
Trihexylamine has 15 rotatable bonds.
What is the topological polar surface area of trihexylamine?
The topological polar surface area of trihexylamine is 3.2Ų.