What is the PubChem CID of the compound?
PubChem CID: 9867644
What is the molecular formula of the compound?
Molecular Formula: C12H5Cl6N3O2
What is the molecular weight of the compound?
Molecular Weight: 435.9 g/mol
When was the compound created?
Create: 2006-10-25
When was the compound last modified?
Modify: 2023-12-30
What is the IUPAC name of the compound?
IUPAC Name: 2-(1,3-benzodioxol-5-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine
What is the InChI of the compound?
InChI: InChI=1S/C12H5Cl6N3O2/c13-11(14,15)9-19-8(20-10(21-9)12(16,17)18)5-1-2-6-7(3-5)23-4-22-6/h1-3H,4H2
What is the InChIKey of the compound?
InChIKey: BFQFFNWLTHFJOZ-UHFFFAOYSA-N
What is the canonical SMILES of the compound?
Canonical SMILES: C1OC2=C(O1)C=C(C=C2)C3=NC(=NC(=N3)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl
What are some synonyms of the compound?
Synonyms: 71255-78-2, 2-(1,3-Benzodioxol-5-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine, Triazine PP, 2-(3,4-METHYLENEDIOXYPHENYL)-4,6-BIS(TRICHLOROMETHYL)-1,3,5-TRIAZINE, CCRIS 9470