What is the molecular formula of Sativan?
The molecular formula of Sativan is C17H18O4.
What is the molecular weight of Sativan?
The molecular weight of Sativan is 286.32 g/mol.
What is the IUPAC name of Sativan?
The IUPAC name of Sativan is 3-(2,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol.
What is the InChI of Sativan?
The InChI of Sativan is InChI=1S/C17H18O4/c1-19-14-5-6-15(17(9-14)20-2)12-7-11-3-4-13(18)8-16(11)21-10-12/h3-6,8-9,12,18H,7,10H2,1-2H3.
What is the InChIKey of Sativan?
The InChIKey of Sativan is TUXCLJQCYVCGDW-UHFFFAOYSA-N.
What is the canonical SMILES of Sativan?
The canonical SMILES of Sativan is COC1=CC(=C(C=C1)C2CC3=C(C=C(C=C3)O)OC2)OC.
What is the CAS number of Sativan?
The CAS number of Sativan is 41743-86-6.
What is the XLogP3-AA value of Sativan?
The XLogP3-AA value of Sativan is 3.3.
How many hydrogen bond donor counts does Sativan have?
Sativan has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Sativan have?
Sativan has 4 hydrogen bond acceptor counts.