What is the molecular formula of sulfonefluorescein?
The molecular formula of sulfonefluorescein is C19H12O6S.
What are the synonyms for sulfonefluorescein?
The synonyms for sulfonefluorescein are sulfonfluorescein and 4424-03-7.
What is the molecular weight of sulfonefluorescein?
The molecular weight of sulfonefluorescein is 368.4 g/mol.
When was sulfonefluorescein created?
Sulfonefluorescein was created on August 8, 2005.
When was sulfonefluorescein last modified?
Sulfonefluorescein was last modified on October 21, 2023.
What is the IUPAC Name of sulfonefluorescein?
The IUPAC Name of sulfonefluorescein is 1,1-dioxospiro[2,1λ6-benzoxathiole-3,9'-xanthene]-3',6'-diol.
What is the InChI of sulfonefluorescein?
The InChI of sulfonefluorescein is InChI=1S/C19H12O6S/c20-11-5-7-13-16(9-11)24-17-10-12(21)6-8-14(17)19(13)15-3-1-2-4-18(15)26(22,23)25-19/h1-10,20-21H.
What is the InChIKey of sulfonefluorescein?
The InChIKey of sulfonefluorescein is VJYGFSGAAOVTLC-UHFFFAOYSA-N.
What is the Canonical SMILES of sulfonefluorescein?
The Canonical SMILES of sulfonefluorescein is C1=CC=C2C(=C1)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OS2(=O)=O.
What is the CAS number of sulfonefluorescein?
The CAS number of sulfonefluorescein is 4424-03-7.
Download
