What is the molecular formula of 2-Bromo-6-phenylpyridine?
The molecular formula of 2-Bromo-6-phenylpyridine is C11H8BrN.
What is the molecular weight of 2-Bromo-6-phenylpyridine?
The molecular weight of 2-Bromo-6-phenylpyridine is 234.09 g/mol.
What is the IUPAC name of 2-Bromo-6-phenylpyridine?
The IUPAC name of 2-Bromo-6-phenylpyridine is 2-bromo-6-phenylpyridine.
What is the InChI of 2-Bromo-6-phenylpyridine?
The InChI of 2-Bromo-6-phenylpyridine is InChI=1S/C11H8BrN/c12-11-8-4-7-10(13-11)9-5-2-1-3-6-9/h1-8H.
What is the InChIKey of 2-Bromo-6-phenylpyridine?
The InChIKey of 2-Bromo-6-phenylpyridine is XIYPPJVLAAXYAB-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromo-6-phenylpyridine?
The Canonical SMILES of 2-Bromo-6-phenylpyridine is C1=CC=C(C=C1)C2=NC(=CC=C2)Br.
What is the CAS number of 2-Bromo-6-phenylpyridine?
The CAS number of 2-Bromo-6-phenylpyridine is 39774-26-0.
What is the EC number of 2-Bromo-6-phenylpyridine?
The EC number of 2-Bromo-6-phenylpyridine is 833-780-3.
What is the DSSTox Substance ID of 2-Bromo-6-phenylpyridine?
The DSSTox Substance ID of 2-Bromo-6-phenylpyridine is DTXSID50340943.
Is 2-Bromo-6-phenylpyridine a covalently-bonded unit?
Yes, 2-Bromo-6-phenylpyridine is a covalently-bonded unit.