What is the molecular formula of Potassium pyruvate?
The molecular formula of Potassium pyruvate is C3H3KO3.
What are the synonyms for Potassium pyruvate?
The synonyms for Potassium pyruvate are potassium 2-oxopropanoate and Potassiumpyruvate.
What is the molecular weight of Potassium pyruvate?
The molecular weight of Potassium pyruvate is 126.15 g/mol.
What is the parent compound of Potassium pyruvate?
The parent compound of Potassium pyruvate is Pyruvic Acid.
How was the molecular weight computed?
The molecular weight was computed by PubChem 2.1.
What is the IUPAC name of Potassium pyruvate?
The IUPAC name of Potassium pyruvate is potassium;2-oxopropanoate.
What is the InChI of Potassium pyruvate?
The InChI of Potassium pyruvate is InChI=1S/C3H4O3.K/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1.
What is the InChIKey of Potassium pyruvate?
The InChIKey of Potassium pyruvate is JKVUQLWTIZFTMF-UHFFFAOYSA-M.
What are the other identifiers for Potassium pyruvate?
The other identifiers for Potassium pyruvate include CAS number 4151-33-1, European Community (EC) Number 223-978-2, and DSSTox Substance ID DTXSID50884039.
What are the chemical and physical properties of Potassium pyruvate?
The chemical and physical properties of Potassium pyruvate include a molecular weight of 126.15 g/mol, no hydrogen bond donor count, 3 hydrogen bond acceptor count, 1 rotatable bond count, an exact mass of 125.97192544 g/mol, a topological polar surface area of 57.2Ų, 7 heavy atom count, a formal charge of 0, and a covalently-bonded unit count of 2.