Neomycin B

• Catalog Number: ACM119040
• Product Name: Neomycin B
• CAS: 119-04-0
• Category: Heterocyclic Organic Compound
• Synonyms: Framycetin;Soframycin;D-Streptamine, O-2,6-diamino-2,6-dideoxy-alpha-D-glucopyranosyl-(1-4)-O-(O-2,6-diamino-2,6-dideoxy-beta-L-idopyranosyl-(1-3)-beta-D-ribofuranosyl-(1-5))-2-deoxy-
• Molecular Weight: 614.64
• Molecular Formula: C23H46N6O13
• Appearance: liquid
• Hazard Statements: Xn
• Physical State: Solid
• Safety Description: 26-36/37/39-45-36/37-23

Custom Q&A

What is the molecular formula of neomycin B?

The molecular formula of neomycin B is C23H46N6O13.

What is the molecular weight of neomycin B?

The molecular weight of neomycin B is 614.6 g/mol.

When was neomycin B created?

Neomycin B was created on June 24, 2005.

What is the IUPAC name of neomycin B?

The IUPAC name of neomycin B is (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,4S,5R)-4-[(2R,3R,4R,5S,6S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxycyclohexyl]oxyoxane-3,4-diol.

What is the InChI of neomycin B?

The InChI of neomycin B is InChI=1S/C23H46N6O13/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22/h5-23,30-36H,1-4,24-29H2/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1.

What is the InChIKey of neomycin B?

The InChIKey of neomycin B is PGBHMTALBVVCIT-VCIWKGPPSA-N.

What is the Canonical SMILES of neomycin B?

The Canonical SMILES of neomycin B is C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)N)OC3C(C(C(O3)CO)OC4C(C(C(C(O4)CN)O)O)N)O)O)N.

What is the CAS number of neomycin B?

The CAS number of neomycin B is 119-04-0.

What is the role of neomycin B?

Neomycin B has a role as an antibacterial drug, an allergen, and an Escherichia coli metabolite.

How is neomycin B derived?

Neomycin B is derived from neomycin and is a glycoside ester of neamine and neobiosamine B.