What is the molecular formula of N,N-Dipropylurea?
The molecular formula of N,N-Dipropylurea is C7H16N2O.
What is the molecular weight of N,N-Dipropylurea?
The molecular weight of N,N-Dipropylurea is 144.21 g/mol.
What is the IUPAC name of N,N-Dipropylurea?
The IUPAC name of N,N-Dipropylurea is 1,1-dipropylurea.
What is the InChI of N,N-Dipropylurea?
The InChI of N,N-Dipropylurea is InChI=1S/C7H16N2O/c1-3-5-9(6-4-2)7(8)10/h3-6H2,1-2H3,(H2,8,10).
What is the InChIKey of N,N-Dipropylurea?
The InChIKey of N,N-Dipropylurea is KTKDYVVUGTXLJK-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Dipropylurea?
The canonical SMILES of N,N-Dipropylurea is CCCN(CCC)C(=O)N.
How many hydrogen bond donor count does N,N-Dipropylurea have?
N,N-Dipropylurea has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does N,N-Dipropylurea have?
N,N-Dipropylurea has 1 hydrogen bond acceptor count.
How many rotatable bond count does N,N-Dipropylurea have?
N,N-Dipropylurea has 4 rotatable bond count.
Is N,N-Dipropylurea a canonical compound?
Yes, N,N-Dipropylurea is a canonical compound.