What is the molecular formula of Methyl 4,5-diaminopicolinate?
The molecular formula is C7H9N3O2.
What are the synonyms for Methyl 4,5-diaminopicolinate?
The synonyms for Methyl 4,5-diaminopicolinate include 850689-13-3, Methyl 4,5-diaminopyridine-2-carboxylate, MFCD13186746, and 2-Pyridinecarboxylic acid, 4,5-diamino-, methyl ester.
What is the molecular weight of Methyl 4,5-diaminopicolinate?
The molecular weight is 167.17 g/mol.
What is the IUPAC name of Methyl 4,5-diaminopicolinate?
The IUPAC name is methyl 4,5-diaminopyridine-2-carboxylate.
What is the InChI of Methyl 4,5-diaminopicolinate?
The InChI is InChI=1S/C7H9N3O2/c1-12-7(11)6-2-4(8)5(9)3-10-6/h2-3H,9H2,1H3,(H2,8,10).
What is the InChIKey of Methyl 4,5-diaminopicolinate?
The InChIKey is PLICIZFHDSQJEI-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 4,5-diaminopicolinate?
The canonical SMILES is COC(=O)C1=NC=C(C(=C1)N)N.
What is the CAS number of Methyl 4,5-diaminopicolinate?
The CAS number is 850689-13-3.
What is the XLogP3-AA value of Methyl 4,5-diaminopicolinate?
The XLogP3-AA value is -0.3.
Is Methyl 4,5-diaminopicolinate a canonicalized compound?
Yes, Methyl 4,5-diaminopicolinate is a canonicalized compound.
※ Please kindly note that our products are for research use only.