What is the molecular formula of Kinetin?
The molecular formula of Kinetin is C10H9N5O.
What is the molecular weight of Kinetin?
The molecular weight of Kinetin is 215.21 g/mol.
What role does Kinetin have?
Kinetin has a role as a geroprotector and a cytokinin.
Where can Kinetin naturally exist?
Kinetin can naturally exist in DNA of organisms including humans and various plants.
What are some synonyms for Kinetin?
Some synonyms for Kinetin include 6-Furfurylaminopurine and 6-Furfuryladenine.
What is the IUPAC name of Kinetin?
The IUPAC name of Kinetin is N-(furan-2-ylmethyl)-7H-purin-6-amine.
What are the InChI and InChIKey of Kinetin?
The InChI of Kinetin is InChI=1S/C10H9N5O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9/h1-3,5-6H,4H2,(H2,11,12,13,14,15) and the InChIKey is QANMHLXAZMSUEX-UHFFFAOYSA-N.
What is the Canonical SMILES of Kinetin?
The Canonical SMILES of Kinetin is C1=COC(=C1)CNC2=NC=NC3=C2NC=N3.
What is the CAS number of Kinetin?
The CAS number of Kinetin is 525-79-1.
What is the XLogP3-AA value of Kinetin?
The XLogP3-AA value of Kinetin is 1.