What is the molecular formula of Hexafluoroglutaric acid?
The molecular formula of Hexafluoroglutaric acid is C5H2F6O4.
What is the molecular weight of Hexafluoroglutaric acid?
The molecular weight of Hexafluoroglutaric acid is 240.06 g/mol.
What is the IUPAC name of Hexafluoroglutaric acid?
The IUPAC name of Hexafluoroglutaric acid is 2,2,3,3,4,4-hexafluoropentanedioic acid.
What is the InChI of Hexafluoroglutaric acid?
The InChI of Hexafluoroglutaric acid is InChI=1S/C5H2F6O4/c6-3(7,1(12)13)5(10,11)4(8,9)2(14)15/h(H,12,13)(H,14,15).
What is the InChIKey of Hexafluoroglutaric acid?
The InChIKey of Hexafluoroglutaric acid is CCUWGJDGLACFQT-UHFFFAOYSA-N.
What is the canonical SMILES of Hexafluoroglutaric acid?
The canonical SMILES of Hexafluoroglutaric acid is C(=O)(C(C(C(C(=O)O)(F)F)(F)F)(F)F)O.
What is the CAS number of Hexafluoroglutaric acid?
The CAS number of Hexafluoroglutaric acid is 376-73-8.
What is the EC number of Hexafluoroglutaric acid?
The EC number of Hexafluoroglutaric acid is 206-813-9.
What is the UNII of Hexafluoroglutaric acid?
The UNII of Hexafluoroglutaric acid is AI43ZAB49W.