What is the molecular formula of DMAC-DPS?
The molecular formula of DMAC-DPS is C42H36N2O2S.
What are the synonyms of DMAC-DPS?
The synonyms of DMAC-DPS include 1477512-32-5 and acridine, 10,10'-(sulfonyldi-4,1-phenylene)bis[9,10-dihydro-9,9-dimethyl-10-[4-[4-(9,9-dimethylacridin-10-yl)phenyl]sulfonylphenyl]-9,9-dimethylacridine.
When was DMAC-DPS created and last modified?
DMAC-DPS was created on August 20, 2012, and it was last modified on December 30, 2023.
What is the IUPAC name of DMAC-DPS?
The IUPAC name of DMAC-DPS is 10-[4-[4-(9,9-dimethylacridin-10-yl)phenyl]sulfonylphenyl]-9,9-dimethylacridine.
What is the InChI of DMAC-DPS?
The InChI of DMAC-DPS is InChI=1S/C42H36N2O2S/c1-41(2)33-13-5-9-17-37(33)43(38-18-10-6-14-34(38)41)29-21-25-31(26-22-29)47(45,46)32-27-23-30(24-28-32)44-39-19-11-7-15-35(39)42(3,4)36-16-8-12-20-40(36)44/h5-28H,1-4H3.
What is the InChIKey of DMAC-DPS?
The InChIKey of DMAC-DPS is CYPVTICNYNXTQP-UHFFFAOYSA-N.
What is the canonical SMILES of DMAC-DPS?
The canonical SMILES of DMAC-DPS is CC1(C2=CC=CC=C2N(C3=CC=CC=C31)C4=CC=C(C=C4)S(=O)(=O)C5=CC=C(C=C5)N6C7=CC=CC=C7C(C8=CC=CC=C86)(C)C).
What is the molecular weight of DMAC-DPS?
The molecular weight of DMAC-DPS is 632.8 g/mol.
What is the XLogP3-AA value of DMAC-DPS?
The XLogP3-AA value of DMAC-DPS is 10.9.
What is the hydrogen bond donor count of DMAC-DPS?
The hydrogen bond donor count of DMAC-DPS is 0.