The synonyms include 95061-51-1, (S)-2-Hydroxy-1,2,2-triphenylethyl acetate, (S)-(-)-2-hydroxy-1,2,2-triphenylethyl acetate, (1s)-2-hydroxy-1,2,2-triphenylethyl acetate, and s-(-)-2-hydroxy-1,2,2-triphenylethyl acetate.
What is the molecular weight of the compound?
The molecular weight is 332.4 g/mol.
When was the compound created and modified?
The compound was created on 2005-07-08 and last modified on 2023-12-30.
What is the IUPAC name of the compound?
The IUPAC name is [(1S)-2-hydroxy-1,2,2-triphenylethyl] acetate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C22H20O3/c1-17(23)25-21(18-11-5-2-6-12-18)22(24,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21,24H,1H3/t21-/m0/s1.
What is the InChIKey of the compound?
The InChIKey is GXLZCXZLVDUDHP-NRFANRHFSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is CC(=O)OC(C1=CC=CC=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.