What is the molecular formula of 1,2,2-Trimethylpiperazine hydrochloride?
The molecular formula of 1,2,2-Trimethylpiperazine hydrochloride is C7H17ClN2.
What is the molecular weight of 1,2,2-Trimethylpiperazine hydrochloride?
The molecular weight of 1,2,2-Trimethylpiperazine hydrochloride is 164.67 g/mol.
What is the PubChem CID of the parent compound of 1,2,2-Trimethylpiperazine hydrochloride?
The PubChem CID of the parent compound of 1,2,2-Trimethylpiperazine hydrochloride is 21973776 (1,2,2-Trimethylpiperazine).
What are the synonyms of 1,2,2-Trimethylpiperazine hydrochloride?
The synonyms of 1,2,2-Trimethylpiperazine hydrochloride are: 1,2,2-trimethylpiperazine hcl, 1,2,2-trimethylpiperazine;hydrochloride, 1,2,2-trimethylpiperazinehydrochloride.
What is the IUPAC name of 1,2,2-Trimethylpiperazine hydrochloride?
The IUPAC name of 1,2,2-Trimethylpiperazine hydrochloride is 1,2,2-trimethylpiperazine;hydrochloride.
What is the InChI of 1,2,2-Trimethylpiperazine hydrochloride?
The InChI of 1,2,2-Trimethylpiperazine hydrochloride is InChI=1S/C7H16N2.ClH/c1-7(2)6-8-4-5-9(7)3;/h8H,4-6H2,1-3H3;1H.
What is the InChIKey of 1,2,2-Trimethylpiperazine hydrochloride?
The InChIKey of 1,2,2-Trimethylpiperazine hydrochloride is AWYYVHSHGGSKCG-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,2-Trimethylpiperazine hydrochloride?
The canonical SMILES of 1,2,2-Trimethylpiperazine hydrochloride is CC1(CNCCN1C)C.Cl.
What is the CAS number of 1,2,2-Trimethylpiperazine hydrochloride?
The CAS number of 1,2,2-Trimethylpiperazine hydrochloride is 1312784-54-5.
What is the complexity of 1,2,2-Trimethylpiperazine hydrochloride?
The complexity of 1,2,2-Trimethylpiperazine hydrochloride is 99.1.