What is the PubChem CID of 2-Chlorophenothiazine?
PubChem CID 7088.
What is the molecular formula of 2-Chlorophenothiazine?
The molecular formula is C12H8ClNS.
What is the molecular weight of 2-Chlorophenothiazine?
The molecular weight is 233.72 g/mol.
What is the IUPAC name of 2-Chlorophenothiazine?
The IUPAC name is 2-chloro-10H-phenothiazine.
What is the InChI of 2-Chlorophenothiazine?
The InChI is InChI=1S/C12H8ClNS/c13-8-5-6-12-10(7-8)14-9-3-1-2-4-11(9)15-12/h1-7,14H.
What is the InChIKey of 2-Chlorophenothiazine?
The InChIKey is KFZGLJSYQXZIGP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chlorophenothiazine?
The canonical SMILES is C1=CC=C2C(=C1)NC3=C(S2)C=CC(=C3)Cl.
What is the CAS number of 2-Chlorophenothiazine?
The CAS number is 92-39-7.
What is the European Community (EC) number of 2-Chlorophenothiazine?
The European Community (EC) number is 202-152-5.
How many hydrogen bond donor counts does 2-Chlorophenothiazine have?
2-Chlorophenothiazine has 1 hydrogen bond donor count.