What is the molecular formula of Biotin-XX-NHS?
The molecular formula of Biotin-XX-NHS is C26H41N5O7S.
What is the synonym for Biotin-XX-NHS?
The synonym for Biotin-XX-NHS is Succinimidyl-6-[6-(biotinamido)caproyl]caproylate.
What is the molecular weight of Biotin-XX-NHS?
The molecular weight of Biotin-XX-NHS is 567.7 g/mol.
When was Biotin-XX-NHS created?
Biotin-XX-NHS was created on July 16, 2007.
What is the IUPAC name of Biotin-XX-NHS?
The IUPAC name of Biotin-XX-NHS is (2,5-dioxopyrrolidin-1-yl) 6-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]hexanoate.
What is the InChI of Biotin-XX-NHS?
The InChI of Biotin-XX-NHS is InChI=1S/C26H41N5O7S/c32-20(27-16-8-2-4-12-24(36)38-31-22(34)13-14-23(31)35)10-3-1-7-15-28-21(33)11-6-5-9-19-25-18(17-39-19)29-26(37)30-25/h18-19,25H,1-17H2,(H,27,32)(H,28,33)(H2,29,30,37)/t18-,19-,25-/m0/s1.
What is the InChIKey of Biotin-XX-NHS?
The InChIKey of Biotin-XX-NHS is ATYCFNRXENKXSE-MHPIHPPYSA-N.
What is the Canonical SMILES of Biotin-XX-NHS?
The Canonical SMILES of Biotin-XX-NHS is C1CC(=O)N(C1=O)OC(=O)CCCCCNC(=O)CCCCCNC(=O)CCCCC2C3C(CS2)NC(=O)N3.
What is the CAS number of Biotin-XX-NHS?
The CAS number of Biotin-XX-NHS is 89889-52-1.
What is the XLogP3-AA value of Biotin-XX-NHS?
The XLogP3-AA value of Biotin-XX-NHS is 0.4.