What is the CAS number of Isohexyl palmitate?
The CAS number of Isohexyl palmitate is 55194-91-7.
What are some synonyms for Isohexyl palmitate?
Some synonyms for Isohexyl palmitate are Hexadecanoic acid, isohexyl ester and 4-Methylpentyl hexadecanoate.
What is the molecular weight of Isohexyl palmitate?
The molecular weight of Isohexyl palmitate is 340.58.
What is the molecular formula of Isohexyl palmitate?
The molecular formula of Isohexyl palmitate is C22H44O2.
What is the SMILES representation of Isohexyl palmitate?
The SMILES representation of Isohexyl palmitate is CCCCCCCCCCCCCCCC(=O)OCCCC(C)C.
What is the InChI Key of Isohexyl palmitate?
The InChI Key of Isohexyl palmitate is InChI=1S/C22H44O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(23)24-20-17-18-21(2)3/h21H,4-20H2,1-3H3.
What is the purity of Isohexyl palmitate?
The purity of Isohexyl palmitate is 96%.
What percentage of Isohexyl palmitate is considered active?
95% of Isohexyl palmitate is considered active.
In what physical state does Isohexyl palmitate exist?
Isohexyl palmitate exists in a liquid physical state.
What is a typical application of Isohexyl palmitate?
A typical application of Isohexyl palmitate is as an emollient.