What is the molecular formula of 5-Chloro-3-benzofuranone?
The molecular formula of 5-Chloro-3-benzofuranone is C8H5ClO2.
What is the molecular weight of 5-Chloro-3-benzofuranone?
The molecular weight of 5-Chloro-3-benzofuranone is 168.57 g/mol.
What is the IUPAC name of 5-Chloro-3-benzofuranone?
The IUPAC name of 5-Chloro-3-benzofuranone is 5-chloro-1-benzofuran-3-one.
What is the InChI of 5-Chloro-3-benzofuranone?
The InChI of 5-Chloro-3-benzofuranone is InChI=1S/C8H5ClO2/c9-5-1-2-8-6(3-5)7(10)4-11-8/h1-3H,4H2.
What is the InChIKey of 5-Chloro-3-benzofuranone?
The InChIKey of 5-Chloro-3-benzofuranone is QQCUCXUMVSGDJH-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Chloro-3-benzofuranone?
The canonical SMILES of 5-Chloro-3-benzofuranone is C1C(=O)C2=C(O1)C=CC(=C2)Cl.
What is the CAS number of 5-Chloro-3-benzofuranone?
The CAS number of 5-Chloro-3-benzofuranone is 3261-05-0.
How many hydrogen bond donor counts are there in 5-Chloro-3-benzofuranone?
There are 0 hydrogen bond donor counts in 5-Chloro-3-benzofuranone.
How many hydrogen bond acceptor counts are there in 5-Chloro-3-benzofuranone?
There are 2 hydrogen bond acceptor counts in 5-Chloro-3-benzofuranone.