What is the molecular formula of 4-Methylesculetin?
The molecular formula of 4-Methylesculetin is C10H8O4.
What is the molecular weight of 4-Methylesculetin?
The molecular weight of 4-Methylesculetin is 192.17 g/mol.
What are the synonyms of 4-Methylesculetin?
The synonyms of 4-Methylesculetin are 6,7-DIHYDROXY-4-METHYLCOUMARIN and Methylesculetin.
What is the IUPAC name of 4-Methylesculetin?
The IUPAC name of 4-Methylesculetin is 6,7-dihydroxy-4-methylchromen-2-one.
What is the InChI representation of 4-Methylesculetin?
The InChI representation of 4-Methylesculetin is InChI=1S/C10H8O4/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,11-12H,1H3.
What is the InChIKey of 4-Methylesculetin?
The InChIKey of 4-Methylesculetin is KVOJTUXGYQVLAJ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methylesculetin?
The canonical SMILES of 4-Methylesculetin is CC1=CC(=O)OC2=CC(=C(C=C12)O)O.
What is the CAS number of 4-Methylesculetin?
The CAS number of 4-Methylesculetin is 529-84-0.
How many hydrogen bond donor counts does 4-Methylesculetin have?
4-Methylesculetin has 2 hydrogen bond donor counts.
What is the topological polar surface area of 4-Methylesculetin?
The topological polar surface area of 4-Methylesculetin is 66.8 Ų.