What is the molecular formula of 4-Imidazoleacetic acid hydrochloride?
The molecular formula of 4-Imidazoleacetic acid hydrochloride is C5H7ClN2O2.
What are the synonyms for 4-Imidazoleacetic acid hydrochloride?
The synonyms for 4-Imidazoleacetic acid hydrochloride are 3251-69-2, 2-(1H-imidazol-5-yl)acetic acid hydrochloride, 2-(1H-Imidazol-4-Yl)Acetic Acid Hydrochloride, and Imidazole-4-acetic acid hydrochloride.
What is the molecular weight of 4-Imidazoleacetic acid hydrochloride?
The molecular weight of 4-Imidazoleacetic acid hydrochloride is 162.57 g/mol.
What is the IUPAC name of 4-Imidazoleacetic acid hydrochloride?
The IUPAC name of 4-Imidazoleacetic acid hydrochloride is 2-(1H-imidazol-5-yl)acetic acid;hydrochloride.
What is the InChI of 4-Imidazoleacetic acid hydrochloride?
The InChI of 4-Imidazoleacetic acid hydrochloride is InChI=1S/C5H6N2O2.ClH/c8-5(9)1-4-2-6-3-7-4;/h2-3H,1H2,(H,6,7)(H,8,9);1H.
What is the InChIKey of 4-Imidazoleacetic acid hydrochloride?
The InChIKey of 4-Imidazoleacetic acid hydrochloride is MWHLCFYPFGFBQO-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Imidazoleacetic acid hydrochloride?
The Canonical SMILES of 4-Imidazoleacetic acid hydrochloride is C1=C(NC=N1)CC(=O)O.Cl.
What is the CAS number of 4-Imidazoleacetic acid hydrochloride?
The CAS number of 4-Imidazoleacetic acid hydrochloride is 3251-69-2.
What is the Hydrogen Bond Donor Count of 4-Imidazoleacetic acid hydrochloride?
The Hydrogen Bond Donor Count of 4-Imidazoleacetic acid hydrochloride is 3.
What is the Rotatable Bond Count of 4-Imidazoleacetic acid hydrochloride?
The Rotatable Bond Count of 4-Imidazoleacetic acid hydrochloride is 2.
※ Please kindly note that our products are for research use only.