What is the IUPAC name of 4-Hydroxybenzophenone?
The IUPAC name of 4-Hydroxybenzophenone is (4-hydroxyphenyl)-phenylmethanone.
What is the molecular weight of 4-Hydroxybenzophenone?
The molecular weight of 4-Hydroxybenzophenone is 198.22.
What is the appearance of 4-Hydroxybenzophenone?
The appearance of 4-Hydroxybenzophenone is white to light yellow to light orange powder to crystal.
What is the boiling point of 4-Hydroxybenzophenone?
The boiling point of 4-Hydroxybenzophenone is 419-420 °C.
What is the purity of 4-Hydroxybenzophenone?
The purity of 4-Hydroxybenzophenone is 99%.
What is the typical application of 4-Hydroxybenzophenone?
The typical applications of 4-Hydroxybenzophenone include use as a UV absorbing agent and as an intermediate in organic synthesis.
What is the storage condition recommended for 4-Hydroxybenzophenone?
The recommended storage condition for 4-Hydroxybenzophenone is 2-8°C.
What is the flash point of 4-Hydroxybenzophenone?
The flash point of 4-Hydroxybenzophenone is 235.4 °F.
What are the synonyms of 4-Hydroxybenzophenone?
The synonyms of 4-Hydroxybenzophenone are P-Benzoylphenol and Methanone, (4-hydroxyphenyl)phenyl-.
What are the CAS number and SMILES representation of 4-Hydroxybenzophenone?
The CAS number of 4-Hydroxybenzophenone is 1137-42-4 and the SMILES representation is Oc1ccc(cc1)C(=O)c2ccccc2.