What is the molecular formula of 4-Bromo-3-fluorophenol?
The molecular formula of 4-Bromo-3-fluorophenol is C6H4BrFO.
What are the synonyms of 4-Bromo-3-fluorophenol?
The synonyms of 4-Bromo-3-fluorophenol are 121219-03-2, 3-Fluoro-4-bromophenol, MFCD00051907, and Phenol, 4-bromo-3-fluoro-.
What is the molecular weight of 4-Bromo-3-fluorophenol?
The molecular weight of 4-Bromo-3-fluorophenol is 191.00 g/mol.
What is the IUPAC name of 4-Bromo-3-fluorophenol?
The IUPAC name of 4-Bromo-3-fluorophenol is 4-bromo-3-fluorophenol.
What is the InChI of 4-Bromo-3-fluorophenol?
The InChI of 4-Bromo-3-fluorophenol is InChI=1S/C6H4BrFO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H.
What is the InChIKey of 4-Bromo-3-fluorophenol?
The InChIKey of 4-Bromo-3-fluorophenol is MRQYTJXVULSNIS-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Bromo-3-fluorophenol?
The Canonical SMILES of 4-Bromo-3-fluorophenol is C1=CC(=C(C=C1O)F)Br.
What other identifiers are associated with 4-Bromo-3-fluorophenol?
The CAS number associated with 4-Bromo-3-fluorophenol is 121219-03-2. It also has other identifiers such as European Community (EC) Number 673-636-5, DSSTox Substance ID DTXSID10381296, and Nikkaji Number J1.905.134J.
What is the XLogP3 value of 4-Bromo-3-fluorophenol?
The XLogP3 value of 4-Bromo-3-fluorophenol is 2.6.
Is 4-Bromo-3-fluorophenol a canonicalized compound?
Yes, 4-Bromo-3-fluorophenol is a canonicalized compound.