What is the molecular formula of 3-Methyl-2-pentanol?
The molecular formula of 3-Methyl-2-pentanol is C6H14O.
What is the molecular weight of 3-Methyl-2-pentanol?
The molecular weight of 3-Methyl-2-pentanol is 102.17 g/mol.
What is the IUPAC name of 3-Methyl-2-pentanol?
The IUPAC name of 3-Methyl-2-pentanol is 3-methylpentan-2-ol.
What is the InChI of 3-Methyl-2-pentanol?
The InChI of 3-Methyl-2-pentanol is InChI=1S/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3.
What is the Canonical SMILES of 3-Methyl-2-pentanol?
The Canonical SMILES of 3-Methyl-2-pentanol is CCC(C)C(C)O.
What is the CAS number of 3-Methyl-2-pentanol?
The CAS number of 3-Methyl-2-pentanol is 565-60-6.
What is the XLogP3-AA value of 3-Methyl-2-pentanol?
The XLogP3-AA value of 3-Methyl-2-pentanol is 1.7.
How many hydrogen bond donor counts does 3-Methyl-2-pentanol have?
3-Methyl-2-pentanol has 1 hydrogen bond donor count.
How many rotatable bond counts does 3-Methyl-2-pentanol have?
3-Methyl-2-pentanol has 2 rotatable bond counts.
What is the topological polar surface area of 3-Methyl-2-pentanol?
The topological polar surface area of 3-Methyl-2-pentanol is 20.2Ų.