What is the molecular formula of 3-Fluorobenzyl bromide?
The molecular formula of 3-Fluorobenzyl bromide is C7H6BrF.
What is the molecular weight of 3-Fluorobenzyl bromide?
The molecular weight of 3-Fluorobenzyl bromide is 189.02 g/mol.
What is the IUPAC name of 3-Fluorobenzyl bromide?
The IUPAC name of 3-Fluorobenzyl bromide is 1-(bromomethyl)-3-fluorobenzene.
What is the InChI of 3-Fluorobenzyl bromide?
The InChI of 3-Fluorobenzyl bromide is InChI=1S/C7H6BrF/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2.
What is the InChIKey of 3-Fluorobenzyl bromide?
The InChIKey of 3-Fluorobenzyl bromide is SCBZBMXPJYMXRC-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluorobenzyl bromide?
The canonical SMILES of 3-Fluorobenzyl bromide is C1=CC(=CC(=C1)F)CBr.
What is the CAS number of 3-Fluorobenzyl bromide?
The CAS number of 3-Fluorobenzyl bromide is 456-41-7.
What is the EC number of 3-Fluorobenzyl bromide?
The EC number of 3-Fluorobenzyl bromide is 207-263-2.
What is the DSSTox Substance ID of 3-Fluorobenzyl bromide?
The DSSTox Substance ID of 3-Fluorobenzyl bromide is DTXSID9060025.
Is 3-Fluorobenzyl bromide a canonicalized compound according to PubChem?
Yes, 3-Fluorobenzyl bromide is a canonicalized compound according to PubChem.