What is the molecular formula of 3-Brome-2-fluoroaniline?
The molecular formula of 3-Brome-2-fluoroaniline is C6H5BrFN.
What is the molecular weight of 3-Brome-2-fluoroaniline?
The molecular weight of 3-Brome-2-fluoroaniline is 190.01 g/mol.
What is the IUPAC name of 3-Brome-2-fluoroaniline?
The IUPAC name of 3-Brome-2-fluoroaniline is 3-bromo-2-fluoroaniline.
What is the InChI of 3-Brome-2-fluoroaniline?
The InChI of 3-Brome-2-fluoroaniline is InChI=1S/C6H5BrFN/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2.
What is the InChIKey of 3-Brome-2-fluoroaniline?
The InChIKey of 3-Brome-2-fluoroaniline is HYPQOSVTIONWSN-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Brome-2-fluoroaniline?
The canonical SMILES of 3-Brome-2-fluoroaniline is C1=CC(=C(C(=C1)Br)F)N.
What is the CAS number of 3-Brome-2-fluoroaniline?
The CAS number of 3-Brome-2-fluoroaniline is 58534-95-5.
What is the European Community (EC) number of 3-Brome-2-fluoroaniline?
The European Community (EC) number of 3-Brome-2-fluoroaniline is 820-692-5.
What is the DSSTox Substance ID of 3-Brome-2-fluoroaniline?
The DSSTox Substance ID of 3-Brome-2-fluoroaniline is DTXSID90625004.
Is 3-Brome-2-fluoroaniline a canonicalized compound?
Yes, 3-Brome-2-fluoroaniline is a canonicalized compound.