What is the molecular formula of 2-Bromo-5-fluoro-4-methylbenzaldehyde?
The molecular formula of 2-Bromo-5-fluoro-4-methylbenzaldehyde is C8H6BrFO.
What are some synonyms of 2-Bromo-5-fluoro-4-methylbenzaldehyde?
Some synonyms of 2-Bromo-5-fluoro-4-methylbenzaldehyde are 916792-21-7, 2-Bromo-5-fluoro-4-methyl benzaldehyde, and BENZALDEHYDE, 2-BROMO-5-FLUORO-4-METHYL-.
What is the molecular weight of 2-Bromo-5-fluoro-4-methylbenzaldehyde?
The molecular weight of 2-Bromo-5-fluoro-4-methylbenzaldehyde is 217.03 g/mol.
When was 2-Bromo-5-fluoro-4-methylbenzaldehyde created?
2-Bromo-5-fluoro-4-methylbenzaldehyde was created on May 29, 2009.
When was 2-Bromo-5-fluoro-4-methylbenzaldehyde last modified?
2-Bromo-5-fluoro-4-methylbenzaldehyde was last modified on December 2, 2023.
What is the IUPAC name of 2-Bromo-5-fluoro-4-methylbenzaldehyde?
The IUPAC name of 2-Bromo-5-fluoro-4-methylbenzaldehyde is 2-bromo-5-fluoro-4-methylbenzaldehyde.
What is the InChI code of 2-Bromo-5-fluoro-4-methylbenzaldehyde?
The InChI code of 2-Bromo-5-fluoro-4-methylbenzaldehyde is InChI=1S/C8H6BrFO/c1-5-2-7(9)6(4-11)3-8(5)10/h2-4H,1H3.
What is the InChIKey of 2-Bromo-5-fluoro-4-methylbenzaldehyde?
The InChIKey of 2-Bromo-5-fluoro-4-methylbenzaldehyde is RKDXMZSJZPGBRQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-fluoro-4-methylbenzaldehyde?
The canonical SMILES of 2-Bromo-5-fluoro-4-methylbenzaldehyde is CC1=CC(=C(C=C1F)C=O)Br.
What is the CAS number of 2-Bromo-5-fluoro-4-methylbenzaldehyde?
The CAS number of 2-Bromo-5-fluoro-4-methylbenzaldehyde is 916792-21-7.
※ Please kindly note that our products are for research use only.