What is the molecular formula of 2-Bromo-4-nitroaniline?
The molecular formula of 2-Bromo-4-nitroaniline is C6H5BrN2O2.
What is the molecular weight of 2-Bromo-4-nitroaniline?
The molecular weight of 2-Bromo-4-nitroaniline is 217.02 g/mol.
What is the IUPAC name of 2-Bromo-4-nitroaniline?
The IUPAC name of 2-Bromo-4-nitroaniline is 2-bromo-4-nitroaniline.
What is the InChI of 2-Bromo-4-nitroaniline?
The InChI of 2-Bromo-4-nitroaniline is InChI=1S/C6H5BrN2O2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H,8H2.
What is the InChIKey of 2-Bromo-4-nitroaniline?
The InChIKey of 2-Bromo-4-nitroaniline is CGPPWNTVTNCHDO-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-nitroaniline?
The canonical SMILES of 2-Bromo-4-nitroaniline is C1=CC(=C(C=C1[N+](=O)[O-])Br)N.
What is the CAS number of 2-Bromo-4-nitroaniline?
The CAS number of 2-Bromo-4-nitroaniline is 13296-94-1.
What is the EC number of 2-Bromo-4-nitroaniline?
The EC number of 2-Bromo-4-nitroaniline is 236-318-3.
What is the DSSTox Substance ID of 2-Bromo-4-nitroaniline?
The DSSTox Substance ID of 2-Bromo-4-nitroaniline is DTXSID3065405.
Is 2-Bromo-4-nitroaniline a canonicalized compound?
Yes, 2-Bromo-4-nitroaniline is a canonicalized compound.