What is the PubChem CID of 2-Bromo-4-chlorotoluene?
The PubChem CID of 2-Bromo-4-chlorotoluene is 609898.
What is the molecular formula of 2-Bromo-4-chlorotoluene?
The molecular formula of 2-Bromo-4-chlorotoluene is C7H6BrCl.
What is the molecular weight of 2-Bromo-4-chlorotoluene?
The molecular weight of 2-Bromo-4-chlorotoluene is 205.48 g/mol.
What is the IUPAC name of 2-Bromo-4-chlorotoluene?
The IUPAC name of 2-Bromo-4-chlorotoluene is 2-bromo-4-chloro-1-methylbenzene.
What is the InChI of 2-Bromo-4-chlorotoluene?
The InChI of 2-Bromo-4-chlorotoluene is InChI=1S/C7H6BrCl/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3.
What is the InChIKey of 2-Bromo-4-chlorotoluene?
The InChIKey of 2-Bromo-4-chlorotoluene is CSUUXPHPCXHYGY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-chlorotoluene?
The canonical SMILES of 2-Bromo-4-chlorotoluene is CC1=C(C=C(C=C1)Cl)Br.
What is the CAS number of 2-Bromo-4-chlorotoluene?
The CAS number of 2-Bromo-4-chlorotoluene is 27139-97-5.
What is the XLogP3 value of 2-Bromo-4-chlorotoluene?
The XLogP3 value of 2-Bromo-4-chlorotoluene is 4.3.
Is 2-Bromo-4-chlorotoluene a canonicalized compound?
Yes, 2-Bromo-4-chlorotoluene is a canonicalized compound.