What is the molecular formula of 2,4-Difluoroiodobenzene?
The molecular formula of 2,4-Difluoroiodobenzene is C6H3F2I.
What is the molecular weight of 2,4-Difluoroiodobenzene?
The molecular weight of 2,4-Difluoroiodobenzene is 239.99 g/mol.
What is the IUPAC name of 2,4-Difluoroiodobenzene?
The IUPAC name of 2,4-Difluoroiodobenzene is 2,4-difluoro-1-iodobenzene.
What is the InChI of 2,4-Difluoroiodobenzene?
The InChI of 2,4-Difluoroiodobenzene is InChI=1S/C6H3F2I/c7-4-1-2-6(9)5(8)3-4/h1-3H.
What is the InChIKey of 2,4-Difluoroiodobenzene?
The InChIKey of 2,4-Difluoroiodobenzene is YKLDMAPEGQYZRT-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Difluoroiodobenzene?
The canonical SMILES of 2,4-Difluoroiodobenzene is C1=CC(=C(C=C1F)F)I.
What is the CAS number of 2,4-Difluoroiodobenzene?
The CAS number of 2,4-Difluoroiodobenzene is 2265-93-2.
What is the EC number of 2,4-Difluoroiodobenzene?
The EC number of 2,4-Difluoroiodobenzene is 629-507-0.
Is 2,4-Difluoroiodobenzene the canonicalized compound?
Yes, 2,4-Difluoroiodobenzene is considered the canonicalized compound.