What is the molecular formula of 2,4-Dibromotoluene?
The molecular formula of 2,4-Dibromotoluene is C7H6Br2.
What is the molecular weight of 2,4-Dibromotoluene?
The molecular weight of 2,4-Dibromotoluene is 249.93 g/mol.
What is the IUPAC name of 2,4-Dibromotoluene?
The IUPAC name of 2,4-Dibromotoluene is 2,4-dibromo-1-methylbenzene.
What is the InChI of 2,4-Dibromotoluene?
The InChI of 2,4-Dibromotoluene is InChI=1S/C7H6Br2/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3.
What is the InChIKey of 2,4-Dibromotoluene?
The InChIKey of 2,4-Dibromotoluene is GHWYNNFPUGEYEM-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dibromotoluene?
The canonical SMILES of 2,4-Dibromotoluene is CC1=C(C=C(C=C1)Br)Br.
What is the CAS number of 2,4-Dibromotoluene?
The CAS number of 2,4-Dibromotoluene is 31543-75-6.
What is the UNII number of 2,4-Dibromotoluene?
The UNII number of 2,4-Dibromotoluene is 5KCL9II3NL.
Is 2,4-Dibromotoluene a canonicalized compound?
Yes, 2,4-Dibromotoluene is a canonicalized compound.