What is the molecular formula of 2,3-dimethoxyphenol?
The molecular formula of 2,3-dimethoxyphenol is C8H10O3.
What is the molecular weight of 2,3-dimethoxyphenol?
The molecular weight of 2,3-dimethoxyphenol is 154.16 g/mol.
What is the IUPAC name of 2,3-dimethoxyphenol?
The IUPAC name of 2,3-dimethoxyphenol is 2,3-dimethoxyphenol.
What is the InChI code of 2,3-dimethoxyphenol?
The InChI code of 2,3-dimethoxyphenol is InChI=1S/C8H10O3/c1-10-7-5-3-4-6(9)8(7)11-2/h3-5,9H,1-2H3.
What is the InChIKey of 2,3-dimethoxyphenol?
The InChIKey of 2,3-dimethoxyphenol is QSZCGGBDNYTQHH-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-dimethoxyphenol?
The canonical SMILES of 2,3-dimethoxyphenol is COC1=CC=CC(=C1OC)O.
What is the CAS number of 2,3-dimethoxyphenol?
The CAS number of 2,3-dimethoxyphenol is 5150-42-5.
What is the XLogP3 value of 2,3-dimethoxyphenol?
The XLogP3 value of 2,3-dimethoxyphenol is 1.2.
How many hydrogen bond donor counts does 2,3-dimethoxyphenol have?
2,3-dimethoxyphenol has one hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2,3-dimethoxyphenol have?
2,3-dimethoxyphenol has three hydrogen bond acceptor counts.