What is the molecular formula of 2,3,4-Trifluorobenzenesulfonyl fluoride?
The molecular formula is C6H2F4O2S.
What are the synonyms of 2,3,4-Trifluorobenzenesulfonyl fluoride?
The synonyms are 2,3,4-trifluorobenzene-1-sulfonyl fluoride, 1640262-06-1, AKOS037478240, 2,3,4-TRIFLUOROBENZENESULFONYLFLUORIDE, 2,3,4-TRIFLUOROBENZENESULFONYL FLUORIDE.
What is the molecular weight of 2,3,4-Trifluorobenzenesulfonyl fluoride?
The molecular weight is 214.14 g/mol.
What is the IUPAC name of 2,3,4-Trifluorobenzenesulfonyl fluoride?
The IUPAC name is 2,3,4-trifluorobenzenesulfonyl fluoride.
What is the InChI of 2,3,4-Trifluorobenzenesulfonyl fluoride?
The InChI is InChI=1S/C6H2F4O2S/c7-3-1-2-4(13(10,11)12)6(9)5(3)8/h1-2H.
What is the InChIKey of 2,3,4-Trifluorobenzenesulfonyl fluoride?
The InChIKey is QSTVOESYDQCSJJ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,3,4-Trifluorobenzenesulfonyl fluoride?
The Canonical SMILES is C1=CC(=C(C(=C1F)F)F)S(=O)(=O)F.
What is the XLogP3-AA value of 2,3,4-Trifluorobenzenesulfonyl fluoride?
The XLogP3-AA value is 2.
How many hydrogen bond donor counts does 2,3,4-Trifluorobenzenesulfonyl fluoride have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,3,4-Trifluorobenzenesulfonyl fluoride have?
It has 6 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.