What is the PubChem CID of 1,2-Benzenedimethanol?
The PubChem CID of 1,2-Benzenedimethanol is 69153.
What is the molecular formula of 1,2-Benzenedimethanol?
The molecular formula of 1,2-Benzenedimethanol is C8H10O2.
What is the molecular weight of 1,2-Benzenedimethanol?
The molecular weight of 1,2-Benzenedimethanol is 138.16 g/mol.
What is the IUPAC name of 1,2-Benzenedimethanol?
The IUPAC name of 1,2-Benzenedimethanol is [2-(hydroxymethyl)phenyl]methanol.
What is the InChI of 1,2-Benzenedimethanol?
The InChI of 1,2-Benzenedimethanol is InChI=1S/C8H10O2/c9-5-7-3-1-2-4-8(7)6-10/h1-4,9-10H,5-6H2.
What is the InChIKey of 1,2-Benzenedimethanol?
The InChIKey of 1,2-Benzenedimethanol is XMUZQOKACOLCSS-UHFFFAOYSA-N.
What is the CAS number of 1,2-Benzenedimethanol?
The CAS number of 1,2-Benzenedimethanol is 612-14-6.
What is the European Community (EC) number of 1,2-Benzenedimethanol?
The European Community (EC) number of 1,2-Benzenedimethanol is 210-293-9.
What is the UNII of 1,2-Benzenedimethanol?
The UNII of 1,2-Benzenedimethanol is M3SLJ97BU6.
Is 1,2-Benzenedimethanol canonicalized?
Yes, 1,2-Benzenedimethanol is canonicalized.