[2-(3-Cyclohexenyl)Ethyl]Trimethoxysilane

• Catalog Number: ACM67592363
• Product Name: [2-(3-Cyclohexenyl)Ethyl]Trimethoxysilane
• CAS: 67592-36-3
• Category: Siloxanes
• IUPAC Name: 2-cyclohex-3-en-1-ylethyl(trimethoxy)silane
• Molecular Weight: 230.38 g/mol
• Molecular Formula: C11H22O3Si
• Canonical SMILES: CO[Si](CCC1CCC=CC1)(OC)OC
• InChI Key: LJNFZEBTNPLCMG-UHFFFAOYSA-N
• Appearance: Transparent liquid
• EC Number: 266-749-2
• Packaging: 10 g; 100 g

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-cyclohex-3-en-1-ylethyl(trimethoxy)silane.

What is the molecular formula of the compound?

The molecular formula of the compound is C11H22O3Si.

What is the CAS number of the compound?

The CAS number of the compound is 67592-36-3.

What is the molecular weight of the compound?

The molecular weight of the compound is 230.38 g/mol.

How many hydrogen bond donor count does the compound have?

The compound has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does the compound have?

The compound has 3 hydrogen bond acceptor count.

How many rotatable bond count does the compound have?

The compound has 6 rotatable bond count.

What is the exact mass of the compound?

The exact mass of the compound is 230.13382109 g/mol.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 27.7Ų.

How many covalently-bonded unit count does the compound have?

The compound has 1 covalently-bonded unit count.