CAS
25998-97-0 Purity
---
25998-97-0 Purity
---
Shopping basket
Phenylmalonic acid
CAS
2613-89-0
Catalog Number
ACM2613890
Category
Polymer/Macromolecule
Molecular Weight
180.16
Molecular Formula
C9H8O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
PHENYLPROPANEDIOC ACID;PHENYLMALONIC ACID;RARECHEM AL BE 1370;phenyl-propanedioicaci;1-Hydroxy-4-(P-Tolyamino)Anthraquinone;alpha-Carboxyphenylaceticacid;Phenylpropanedionicacid;PHENYLPROPANEDIOIC ACID
What is the molecular formula of Phenylmalonic acid?
The molecular formula of Phenylmalonic acid is C9H8O4.
What is the molecular weight of Phenylmalonic acid?
The molecular weight of Phenylmalonic acid is 180.16 g/mol.
What is the IUPAC name of Phenylmalonic acid?
The IUPAC name of Phenylmalonic acid is 2-phenylpropanedioic acid.
What is the Canonical SMILES representation of Phenylmalonic acid?
The Canonical SMILES representation of Phenylmalonic acid is C1=CC=C(C=C1)C(C(=O)O)C(=O)O.
How many hydrogen bond donor counts are there in Phenylmalonic acid?
There are 2 hydrogen bond donor counts in Phenylmalonic acid.
What is the exact mass of Phenylmalonic acid?
The exact mass of Phenylmalonic acid is 180.04225873 g/mol.
What is the topological polar surface area of Phenylmalonic acid?
The topological polar surface area of Phenylmalonic acid is 74.6Ų.
How many heavy atoms are present in Phenylmalonic acid?
There are 13 heavy atoms present in Phenylmalonic acid.
How many rotatable bond counts are there in Phenylmalonic acid?
There are 3 rotatable bond counts in Phenylmalonic acid.
What is the complexity value of Phenylmalonic acid?
The complexity value of Phenylmalonic acid is 192.
Please kindly note that our products are for research use only.
Recommended Products
