What is the molecular formula of tris(nonylphenyl)phosphite?
The molecular formula of tris(nonylphenyl)phosphite is C45H69O3P.
What is the molecular weight of tris(nonylphenyl)phosphite?
The molecular weight of tris(nonylphenyl)phosphite is 689.0 g/mol.
What is the IUPAC name of tris(nonylphenyl)phosphite?
The IUPAC name of tris(nonylphenyl)phosphite is tris(2-nonylphenyl)phosphite.
What is the InChI of tris(nonylphenyl)phosphite?
The InChI of tris(nonylphenyl)phosphite is InChI=1S/C45H69O3P/c1-4-7-10-13-16-19-22-31-40-34-25-28-37-43(40)46-49(47-44-38-29-26-35-41(44)32-23-20-17-14-11-8-5-2)48-45-39-30-27-36-42(45)33-24-21-18-15-12-9-6-3/h25-30,34-39H,4-24,31-33H2,1-3H3.
What is the InChIKey of tris(nonylphenyl)phosphite?
The InChIKey of tris(nonylphenyl)phosphite is WGKLOLBTFWFKOD-UHFFFAOYSA-N.
What is the canonical SMILES of tris(nonylphenyl)phosphite?
The canonical SMILES of tris(nonylphenyl)phosphite is CCCCCCCCCC1=CC=CC=C1OP(OC2=CC=CC=C2CCCCCCCCC)OC3=CC=CC=C3CCCCCCCCC.
What is the CAS number of tris(nonylphenyl)phosphite?
The CAS number of tris(nonylphenyl)phosphite is 26523-78-4.
What is the UNII of tris(nonylphenyl)phosphite?
The UNII of tris(nonylphenyl)phosphite is 7KV2DH7E7A.
What is the XLogP3-AA value of tris(nonylphenyl)phosphite?
The XLogP3-AA value of tris(nonylphenyl)phosphite is 19.3.
What is the topological polar surface area of tris(nonylphenyl)phosphite?
The topological polar surface area of tris(nonylphenyl)phosphite is 27.7Ų.
※ Please kindly note that our products are for research use only.