N10-(Trifluoroacetyl)pteroic acid

• CAS: 37793-53-6
• Catalog Number: ACM37793536
• Category: Main Products
• Molecular Weight: 408.29
• Molecular Formula: C16H11F3N6O4
• Appearance: Powder

Custom Q&A

What is the molecular formula of n10-(Trifluoroacetyl)pteroic acid?

The molecular formula is C16H11F3N6O4.

What are the synonyms for n10-(Trifluoroacetyl)pteroic acid?

Some synonyms include 37793-53-6, N10-(Trifluoroacetyl)pteroic acid, and 4-[(2-amino-4-oxo-1H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetamido)benzoic acid.

What is the molecular weight of n10-(Trifluoroacetyl)pteroic acid?

The molecular weight is 408.29 g/mol.

What is the InChIKey for n10-(Trifluoroacetyl)pteroic acid?

The InChIKey is IJGIHDXKYQLIMA-UHFFFAOYSA-N.

What is the Canonical SMILES representation of n10-(Trifluoroacetyl)pteroic acid?

The Canonical SMILES is C1=CC(=CC=C1C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)C(=O)C(F)(F)F.

What is the topological polar surface area of n10-(Trifluoroacetyl)pteroic acid?

The topological polar surface area is 151 Ų.

How many hydrogen bond donor counts does n10-(Trifluoroacetyl)pteroic acid have?

It has 3 hydrogen bond donor counts.

What is the exact mass and monoisotopic mass of n10-(Trifluoroacetyl)pteroic acid?

The exact mass and monoisotopic mass are both 408.07938734 g/mol.

How many rotatable bond counts does n10-(Trifluoroacetyl)pteroic acid have?

It has 4 rotatable bond counts.

What is the complexity of n10-(Trifluoroacetyl)pteroic acid?

The complexity is 707.