N-(3,5-Dichlorophenyl)thiourea

• Catalog Number: ACMA00001496
• Category: Amines
• Molecular Weight: 221.11
• Molecular Formula: C₇H₆ClNS
• Hazard Statements: H302-H319
• RIDADR: UN 2941 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of N-(3,5-Dichlorophenyl)thiourea?

The molecular formula is C7H6Cl2N2S.

What is the molecular weight of N-(3,5-Dichlorophenyl)thiourea?

The molecular weight is 221.11 g/mol.

What is the IUPAC name of N-(3,5-Dichlorophenyl)thiourea?

The IUPAC name is (3,5-dichlorophenyl)thiourea.

What is the InChI of N-(3,5-Dichlorophenyl)thiourea?

The InChI of N-(3,5-Dichlorophenyl)thiourea is InChI=1S/C7H6Cl2N2S/c8-4-1-5(9)3-6(2-4)11-7(10)12/h1-3H,(H3,10,11,12).

What is the InChIKey of N-(3,5-Dichlorophenyl)thiourea?

The InChIKey is BNJARXOEVLYKDN-UHFFFAOYSA-N.

What is the Canonical SMILES of N-(3,5-Dichlorophenyl)thiourea?

The Canonical SMILES is C1=C(C=C(C=C1Cl)Cl)NC(=S)N.

What is the CAS number of N-(3,5-Dichlorophenyl)thiourea?

The CAS number is 107707-33-5.

What is the ChEMBL ID of N-(3,5-Dichlorophenyl)thiourea?

The ChEMBL ID is CHEMBL1461007.

What is the XLogP3-AA value of N-(3,5-Dichlorophenyl)thiourea?

The XLogP3-AA value is 2.4.

Is N-(3,5-Dichlorophenyl)thiourea a canonicalized compound?

Yes, N-(3,5-Dichlorophenyl)thiourea is canonicalized.