CAS
--- Purity
---
--- Purity
---
Shopping basket
2-(Trifluoromethylthio)aniline
Catalog Number
ACMA00001494
Category
Amines
Molecular Weight
193.19
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302 + H312-H330-H373
RIDADR
NONH for all modes of transport
Symbol
GHS06
What is the molecular formula of the compound?
The molecular formula of the compound is C7H6F3NS.
What is the molecular weight of the compound?
The molecular weight of the compound is 193.19 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(trifluoromethylsulfanyl)aniline.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H6F3NS/c8-7(9,10)12-6-4-2-1-3-5(6)11/h1-4H,11H2.
What is the InChIKey of the compound?
The InChIKey of the compound is HIPLFBJHUALLRK-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC=C(C(=C1)N)SC(F)(F)F.
What is the CAS number of the compound?
The CAS number of the compound is 347-55-7.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 206-473-1.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID3059840.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
