CAS
925233-25-6 Purity
---
925233-25-6 Purity
---
Shopping basket
Phenol,2-chloro-3-[3-(methoxymethyl)-1-pyrrolidinyl]-
CAS
925233-28-9
Catalog Number
ACM925233289
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-chloro-3-[3-(methoxymethyl)pyrrolidin-1-yl]phenol.
What is the molecular formula of the compound?
The molecular formula of the compound is C12H16ClNO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 241.71 g/mol.
What is the InChIKey of the compound?
The InChIKey of the compound is IHNFECYGBKJIRO-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COCC1CCN(C1)C2=C(C(=CC=C2)O)Cl.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 32.7?2.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Please kindly note that our products are for research use only.
Recommended Products
