CAS
920750-80-7 Purity
---
920750-80-7 Purity
---
Shopping basket
2-Chloro-3-methylbenzoic acid methyl ester
CAS
920759-93-9
Catalog Number
ACM920759939
Category
Other Products
Molecular Formula
C9H9ClO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Chloro-3-methylbenzoic acid methyl ester?
The molecular formula of 2-Chloro-3-methylbenzoic acid methyl ester is C9H9ClO2.
What is the molecular weight of 2-Chloro-3-methylbenzoic acid methyl ester?
The molecular weight of 2-Chloro-3-methylbenzoic acid methyl ester is 184.62 g/mol.
What are some synonyms for 2-Chloro-3-methylbenzoic acid methyl ester?
Some synonyms for 2-Chloro-3-methylbenzoic acid methyl ester include Methyl 2-Chloro-3-methylbenzoate, 920759-93-9, and MFCD11226202.
What is the IUPAC name of 2-Chloro-3-methylbenzoic acid methyl ester?
The IUPAC name of 2-Chloro-3-methylbenzoic acid methyl ester is methyl 2-chloro-3-methylbenzoate.
What is the InChIKey of 2-Chloro-3-methylbenzoic acid methyl ester?
The InChIKey of 2-Chloro-3-methylbenzoic acid methyl ester is ZQPNEFLGTOZVIC-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Chloro-3-methylbenzoic acid methyl ester?
The canonical SMILES representation of 2-Chloro-3-methylbenzoic acid methyl ester is CC1=C(C(=CC=C1)C(=O)OC)Cl.
How many hydrogen bond donor counts are there in 2-Chloro-3-methylbenzoic acid methyl ester?
There are 0 hydrogen bond donor counts in 2-Chloro-3-methylbenzoic acid methyl ester.
How many rotatable bond counts are there in 2-Chloro-3-methylbenzoic acid methyl ester?
There are 2 rotatable bond counts in 2-Chloro-3-methylbenzoic acid methyl ester.
What is the topological polar surface area of 2-Chloro-3-methylbenzoic acid methyl ester?
The topological polar surface area of 2-Chloro-3-methylbenzoic acid methyl ester is 26.3 Ų.
Is the compound canonicalized for 2-Chloro-3-methylbenzoic acid methyl ester?
Yes, the compound is canonicalized for 2-Chloro-3-methylbenzoic acid methyl ester according to PubChem (release 2019.01.04).
Recommended Products
![4-Isoxazolecarboxylic acid,5-[(butylamino)carbonyl]-3-[[(2,5-dimethylphenyl)thio]methyl]-](https://resource.alfa-chemistry.com/structure/920750-80-7.gif)
CAS
92075-69-9 Purity
96%
92075-69-9 Purity
96%
CAS
92077-74-2 Purity
---
92077-74-2 Purity
---
