What is the molecular formula of 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci)?
The molecular formula is C13H12O4.
When was 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci) created and last modified?
It was created on April 7, 2016, and last modified on December 30, 2023.
What is the IUPAC Name of 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci)?
The IUPAC name is (1R,8S)-tricyclo[6.2.1.0 2,7 ]undeca-2,4,6-triene-9,10-dicarboxylic acid.
What is the InChIKey of 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci)?
The InChIKey is FMDJPIDUSFJPFC-IXBNRNDTSA-N.
What is the Canonical SMILES of 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci)?
The Canonical SMILES is C1C2C(C(C1C3=CC=CC=C23)C(=O)O)C(=O)O.
What is the XLogP3-AA value of 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci)?
The XLogP3-AA value is 1.2.
How many hydrogen bond donor counts are there in 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci)?
There are 2 hydrogen bond donor counts.
What is the exact mass of 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci)?
The exact mass is 232.07355886 g/mol.
How many defined atom stereocenter counts are there in 1,4-Methanonaphthalene-2,3-dicarboxylicacid,1,2,3,4-tetrahydro-(7ci)?
There are 2 defined atom stereocenter counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.