Acryloxytriphenyltin

• CAS: 24929-38-2
• Catalog Number: ACM24929382
• Category: Organic Tin
• Molecular Weight: 421.08
• Molecular Formula: C₂₁H₁₈O₂Sn
• Synonyms: ACRYLOXYTRIPHENYLTIN;Acryloxytriphenyltin 95%;ACRYLOXYTRIPHENYLTIN, tech-95

Custom Q&A

What is the molecular formula of Acryloxytriphenyltin?

The molecular formula of Acryloxytriphenyltin is C21H18O2Sn.

What is the molecular weight of Acryloxytriphenyltin?

The molecular weight of Acryloxytriphenyltin is 421.1 g/mol.

What is the IUPAC name of Acryloxytriphenyltin?

The IUPAC name of Acryloxytriphenyltin is triphenylstannyl prop-2-enoate.

What is the InChI code for Acryloxytriphenyltin?

The InChI code for Acryloxytriphenyltin is InChI=1S/3C6H5.C3H4O2.Sn/c3*1-2-4-6-5-3-1;1-2-3(4)5;/h3*1-5H;2H,1H2,(H,4,5);/q;;;;+1/p-1.

What is the InChIKey for Acryloxytriphenyltin?

The InChIKey for Acryloxytriphenyltin is ZBOZYQUPHVWBCE-UHFFFAOYSA-M.

What is the Canonical SMILES for Acryloxytriphenyltin?

The Canonical SMILES for Acryloxytriphenyltin is C=CC(=O)O[Sn](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.

How many hydrogen bond acceptor counts does Acryloxytriphenyltin have?

Acryloxytriphenyltin has 2 hydrogen bond acceptor counts.

What is the exact mass of Acryloxytriphenyltin?

The exact mass of Acryloxytriphenyltin is 422.032882 g/mol.

How many rotatable bond counts does Acryloxytriphenyltin have?

Acryloxytriphenyltin has 6 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.