What is the molecular formula of Diphenyltin oxide?
The molecular formula of Diphenyltin oxide is C12H10OSn.
What is the molecular weight of Diphenyltin oxide?
The molecular weight of Diphenyltin oxide is 288.92 g/mol.
What is the IUPAC name of Diphenyltin oxide?
The IUPAC name of Diphenyltin oxide is oxo(diphenyl)tin.
What is the InChI of Diphenyltin oxide?
The InChI of Diphenyltin oxide is InChI=1S/2C6H5.O.Sn/c2*1-2-4-6-5-3-1;;/h2*1-5H;;.
What is the InChIKey of Diphenyltin oxide?
The InChIKey of Diphenyltin oxide is VPPWQRIBARKZNY-UHFFFAOYSA-N.
What is the canonical SMILES of Diphenyltin oxide?
The canonical SMILES of Diphenyltin oxide is C1=CC=C(C=C1)[Sn](=O)C2=CC=CC=C2.
What is the CAS number of Diphenyltin oxide?
The CAS number of Diphenyltin oxide is 2273-51-0.
What is the EC number of Diphenyltin oxide?
The EC number of Diphenyltin oxide is 218-883-8.
What is the hydrogen bond donor count of Diphenyltin oxide?
The hydrogen bond donor count of Diphenyltin oxide is 0.
Is Diphenyltin oxide a canonicalized compound?
Yes, Diphenyltin oxide is a canonicalized compound according to PubChem.