6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid

• CAS: 445289-20-3
• Catalog Number: ACM445289203
• Category: Bromine Series
• Molecular Weight: 386.24
• Molecular Formula: C₁₉H₁₆BrNO₃
• Synonyms: 6-BROMO-2-(3-ISOPROPOXY-PHENYL)-QUINOLINE-4-CARBOXYLIC ACID

Custom Q&A

What is the molecular formula of 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid?

The molecular formula is C19H16BrNO3.

What is the molecular weight of 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid?

The molecular weight is 386.2 g/mol.

What is the IUPAC name of 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid?

The IUPAC name is 6-bromo-2-(3-propan-2-yloxyphenyl)quinoline-4-carboxylic acid.

What is the InChI of 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid?

The InChI is InChI=1S/C19H16BrNO3/c1-11(2)24-14-5-3-4-12(8-14)18-10-16(19(22)23)15-9-13(20)6-7-17(15)21-18/h3-11H,1-2H3,(H,22,23).

What is the InChIKey of 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid?

The InChIKey is YVECGKPYFNVLAC-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid?

The canonical SMILES is CC(C)OC1=CC=CC(=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O.

What is the XLogP3-AA value of 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid?

The XLogP3-AA value is 4.8.

How many hydrogen bond donor count does 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid have?

It has 4 hydrogen bond acceptor count.

How many rotatable bond count does 6-Bromo-2-(3-isopropoxyphenyl)quinoline-4-carboxylic acid have?

It has 4 rotatable bond count.